C17H27N3O6S2 — CID 162365458
ethyl (2R)-4-[4-(diethylsulfamoyl)phenyl]sulfonylpiperazine-2-carboxylate (PubChem CID 162365458) has the molecular formula C17H27N3O6S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl (2R)-4-[4-(diethylsulfamoyl)phenyl]sulfonylpiperazine-2-carboxylate.
| Compound Name | ethyl (2R)-4-[4-(diethylsulfamoyl)phenyl]sulfonylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 162365458 |
| Molecular Formula | C17H27N3O6S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl (2R)-4-[4-(diethylsulfamoyl)phenyl]sulfonylpiperazine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CN(S(=O)(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)CCN1 |
| InChI | InChI=1S/C17H27N3O6S2/c1-4-19(5-2)27(22,23)14-7-9-15(10-8-14)28(24,25)20-12-11-18-16(13-20)17(21)26-6-3/h7-10,16,18H,4-6,11-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | LECRAXFGHVXGFB-MRXNPFEDSA-N |
| XLogP | 0.24 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |