C17H20Cl2N2O4S — CID 22710075
ethyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carboxylate;hydrochloride (PubChem CID 22710075) has the molecular formula C17H20Cl2N2O4S and a molecular weight of 419.33 g/mol. Its IUPAC name is ethyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22710075 |
| Molecular Formula | C17H20Cl2N2O4S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | ethyl 4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CCN1.Cl |
| InChI | InChI=1S/C17H19ClN2O4S.ClH/c1-2-24-17(21)16-11-20(8-7-19-16)25(22,23)15-6-4-12-9-14(18)5-3-13(12)10-15;/h3-6,9-10,16,19H,2,7-8,11H2,1H3;1H |
| InChIKey | CFAOFQCHFVWYCV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |