C19H23ClN4O5S — CID 22710558
ethyl 2-[2-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carbonyl]hydrazinyl]acetate (PubChem CID 22710558) has the molecular formula C19H23ClN4O5S and a molecular weight of 454.94 g/mol. Its IUPAC name is ethyl 2-[2-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carbonyl]hydrazinyl]acetate.
| Compound Name | ethyl 2-[2-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carbonyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 22710558 |
| Molecular Formula | C19H23ClN4O5S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | ethyl 2-[2-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-2-carbonyl]hydrazinyl]acetate |
| SMILES | CCOC(=O)CNNC(=O)C1CN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CCN1 |
| InChI | InChI=1S/C19H23ClN4O5S/c1-2-29-18(25)11-22-23-19(26)17-12-24(8-7-21-17)30(27,28)16-6-4-13-9-15(20)5-3-14(13)10-16/h3-6,9-10,17,21-22H,2,7-8,11-12H2,1H3,(H,23,26) |
| InChIKey | FXXHFORJQSCVCO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|