C14H21NO2S — CID 58394752
(3S)-1-(benzenesulfonyl)-3-propan-2-ylpiperidine (PubChem CID 58394752) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-3-propan-2-ylpiperidine.
| Compound Name | (3S)-1-(benzenesulfonyl)-3-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 58394752 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-3-propan-2-ylpiperidine |
| SMILES | CC(C)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C14H21NO2S/c1-12(2)13-7-6-10-15(11-13)18(16,17)14-8-4-3-5-9-14/h3-5,8-9,12-13H,6-7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | NZNHBASHWZFQPJ-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |