C15H24N2O4S2 — CID 124684747
(1R)-1-[(3R)-1-(4-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]ethanamine (PubChem CID 124684747) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (1R)-1-[(3R)-1-(4-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]ethanamine.
| Compound Name | (1R)-1-[(3R)-1-(4-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 124684747 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (1R)-1-[(3R)-1-(4-ethylsulfonylphenyl)sulfonylpiperidin-3-yl]ethanamine |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)N2CCC[C@@H]([C@@H](C)N)C2)cc1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-3-22(18,19)14-6-8-15(9-7-14)23(20,21)17-10-4-5-13(11-17)12(2)16/h6-9,12-13H,3-5,10-11,16H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | IEAWSFOKBZPCCN-CHWSQXEVSA-N |
| XLogP | 1.23 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |