C17H29ClN2O4S — CID 119984624
1-[1-[4-(2-ethoxyethoxy)phenyl]sulfonylpiperidin-3-yl]ethanamine;hydrochloride (PubChem CID 119984624) has the molecular formula C17H29ClN2O4S and a molecular weight of 392.95 g/mol. Its IUPAC name is 1-[1-[4-(2-ethoxyethoxy)phenyl]sulfonylpiperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[4-(2-ethoxyethoxy)phenyl]sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119984624 |
| Molecular Formula | C17H29ClN2O4S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[1-[4-(2-ethoxyethoxy)phenyl]sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CCOCCOc1ccc(S(=O)(=O)N2CCCC(C(C)N)C2)cc1.Cl |
| InChI | InChI=1S/C17H28N2O4S.ClH/c1-3-22-11-12-23-16-6-8-17(9-7-16)24(20,21)19-10-4-5-15(13-19)14(2)18;/h6-9,14-15H,3-5,10-13,18H2,1-2H3;1H |
| InChIKey | XHDLXAVDENFDAI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|