C16H27ClN2O3S — CID 119959783
1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 119959783) has the molecular formula C16H27ClN2O3S and a molecular weight of 362.92 g/mol. Its IUPAC name is 1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119959783 |
| Molecular Formula | C16H27ClN2O3S |
| Molecular Weight | 362.92 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[4-(3-methylbutoxy)phenyl]sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CC(C)CCOc1ccc(S(=O)(=O)N2CCCC(N)C2)cc1.Cl |
| InChI | InChI=1S/C16H26N2O3S.ClH/c1-13(2)9-11-21-15-5-7-16(8-6-15)22(19,20)18-10-3-4-14(17)12-18;/h5-8,13-14H,3-4,9-12,17H2,1-2H3;1H |
| InChIKey | PAHZJHYSMHFOCH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |