C12H15N3O3 — CID 63105110
1-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-phenylurea (PubChem CID 63105110) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-phenylurea.
| Compound Name | 1-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-phenylurea |
|---|---|
| PubChem CID | 63105110 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]-3-phenylurea |
| SMILES | O=C(NCC(=O)N1CC(O)C1)Nc1ccccc1 |
| InChI | InChI=1S/C12H15N3O3/c16-10-7-15(8-10)11(17)6-13-12(18)14-9-4-2-1-3-5-9/h1-5,10,16H,6-8H2,(H2,13,14,18) |
| InChIKey | PQTRSCOTLDUNNS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |