C12H16N4O5S — CID 97257336
(2S)-N-(3-nitrophenyl)-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide (PubChem CID 97257336) has the molecular formula C12H16N4O5S and a molecular weight of 328.35 g/mol. Its IUPAC name is (2S)-N-(3-nitrophenyl)-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(3-nitrophenyl)-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97257336 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (2S)-N-(3-nitrophenyl)-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
| SMILES | NS(=O)(=O)C[C@@H]1CCCN1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O5S/c13-22(20,21)8-11-5-2-6-15(11)12(17)14-9-3-1-4-10(7-9)16(18)19/h1,3-4,7,11H,2,5-6,8H2,(H,14,17)(H2,13,20,21)/t11-/m0/s1 |
| InChIKey | JPEGPZDAFOWNLA-NSHDSACASA-N |
| XLogP | 0.88 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|