C19H23N3O5S — CID 97334552
(2R)-N-[4-(2-methoxyphenoxy)phenyl]-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide (PubChem CID 97334552) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is (2R)-N-[4-(2-methoxyphenoxy)phenyl]-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[4-(2-methoxyphenoxy)phenyl]-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97334552 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2R)-N-[4-(2-methoxyphenoxy)phenyl]-2-(sulfamoylmethyl)pyrrolidine-1-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)N2CCC[C@@H]2CS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-26-17-6-2-3-7-18(17)27-16-10-8-14(9-11-16)21-19(23)22-12-4-5-15(22)13-28(20,24)25/h2-3,6-11,15H,4-5,12-13H2,1H3,(H,21,23)(H2,20,24,25)/t15-/m1/s1 |
| InChIKey | YOJVVJCNSXGLIY-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |