C17H19N3O4 — CID 7070883
(1R,2S)-2-N-(2-nitrophenyl)-1-N-prop-2-enylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 7070883) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1R,2S)-2-N-(2-nitrophenyl)-1-N-prop-2-enylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | (1R,2S)-2-N-(2-nitrophenyl)-1-N-prop-2-enylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 7070883 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (1R,2S)-2-N-(2-nitrophenyl)-1-N-prop-2-enylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)[C@@H]1CC=CC[C@@H]1C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N3O4/c1-2-11-18-16(21)12-7-3-4-8-13(12)17(22)19-14-9-5-6-10-15(14)20(23)24/h2-6,9-10,12-13H,1,7-8,11H2,(H,18,21)(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | JLQPQZNXOIIXPL-OLZOCXBDSA-N |
| XLogP | 2.42 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|