C11H14NO3- — CID 6993065
(1S,6R)-6-(prop-2-enylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 6993065) has the molecular formula C11H14NO3- and a molecular weight of 208.24 g/mol. Its IUPAC name is (1S,6R)-6-(prop-2-enylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6R)-6-(prop-2-enylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6993065 |
| Molecular Formula | C11H14NO3- |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1S,6R)-6-(prop-2-enylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | C=CCNC(=O)[C@@H]1CC=CC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C11H15NO3/c1-2-7-12-10(13)8-5-3-4-6-9(8)11(14)15/h2-4,8-9H,1,5-7H2,(H,12,13)(H,14,15)/p-1/t8-,9+/m1/s1 |
| InChIKey | WOVNLQWKGISOPF-BDAKNGLRSA-M |
| XLogP | -0.38 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|