C11H17NO2 — CID 130992166
(1S,2R,4R,6S)-6-hydroxy-N-prop-2-enylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 130992166) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S,2R,4R,6S)-6-hydroxy-N-prop-2-enylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4R,6S)-6-hydroxy-N-prop-2-enylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 130992166 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S,2R,4R,6S)-6-hydroxy-N-prop-2-enylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1C[C@H]2C[C@@H]1[C@@H](O)C2 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-12-11(14)9-5-7-4-8(9)10(13)6-7/h2,7-10,13H,1,3-6H2,(H,12,14)/t7-,8+,9-,10+/m1/s1 |
| InChIKey | OQUCRGWQXQXAOR-RGOKHQFPSA-N |
| XLogP | 0.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|