C22H25NO — CID 18556094
piperidin-1-yl-[(1S,8R,9S,14S,15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl]methanone (PubChem CID 18556094) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is piperidin-1-yl-[(1S,8R,9S,14S,15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl]methanone.
| Compound Name | piperidin-1-yl-[(1S,8R,9S,14S,15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl]methanone |
|---|---|
| PubChem CID | 18556094 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | piperidin-1-yl-[(1S,8R,9S,14S,15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl]methanone |
| SMILES | O=C([C@@H]1C[C@H]2c3ccccc3[C@H]1[C@H]1C=CC=C[C@@H]12)N1CCCCC1 |
| InChI | InChI=1S/C22H25NO/c24-22(23-12-6-1-7-13-23)20-14-19-15-8-2-4-10-17(15)21(20)18-11-5-3-9-16(18)19/h2-5,8-11,15,17,19-21H,1,6-7,12-14H2/t15-,17-,19+,20+,21+/m0/s1 |
| InChIKey | MJBJDGFKKCIXET-QFOJKKOJSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |