C20H16N4O4 — CID 6009175
N-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide (PubChem CID 6009175) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 6009175 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide |
| SMILES | O=C(CNC(=O)c1cccc2ccccc12)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16N4O4/c25-19(23-22-12-14-8-10-16(11-9-14)24(27)28)13-21-20(26)18-7-3-5-15-4-1-2-6-17(15)18/h1-12H,13H2,(H,21,26)(H,23,25)/b22-12- |
| InChIKey | NPTJAARHYSZKKG-UUYOSTAYSA-N |
| XLogP | 2.63 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|