C12H5F5N4O4 — CID 102206781
(Z)-3-[(2,4-dinitrophenyl)methylideneamino]-4,4,5,5,5-pentafluoropent-2-enenitrile (PubChem CID 102206781) has the molecular formula C12H5F5N4O4 and a molecular weight of 364.19 g/mol. Its IUPAC name is (Z)-3-[(2,4-dinitrophenyl)methylideneamino]-4,4,5,5,5-pentafluoropent-2-enenitrile.
| Compound Name | (Z)-3-[(2,4-dinitrophenyl)methylideneamino]-4,4,5,5,5-pentafluoropent-2-enenitrile |
|---|---|
| PubChem CID | 102206781 |
| Molecular Formula | C12H5F5N4O4 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (Z)-3-[(2,4-dinitrophenyl)methylideneamino]-4,4,5,5,5-pentafluoropent-2-enenitrile |
| SMILES | N#C/C=C(\N=C\c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F5N4O4/c13-11(14,12(15,16)17)10(3-4-18)19-6-7-1-2-8(20(22)23)5-9(7)21(24)25/h1-3,5-6H/b10-3-,19-6+ |
| InChIKey | PVDMHILNECMGPA-AGYDMZCQSA-N |
| XLogP | 3.53 |
| TPSA | 122.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|