C12H7F3N2O2 — CID 101225984
(2E,4E)-5-(3-nitrophenyl)-3-(trifluoromethyl)penta-2,4-dienenitrile (PubChem CID 101225984) has the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. Its IUPAC name is (2E,4E)-5-(3-nitrophenyl)-3-(trifluoromethyl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(3-nitrophenyl)-3-(trifluoromethyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 101225984 |
| Molecular Formula | C12H7F3N2O2 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (2E,4E)-5-(3-nitrophenyl)-3-(trifluoromethyl)penta-2,4-dienenitrile |
| SMILES | N#C/C=C(\C=C\c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C12H7F3N2O2/c13-12(14,15)10(6-7-16)5-4-9-2-1-3-11(8-9)17(18)19/h1-6,8H/b5-4+,10-6+ |
| InChIKey | SNNDXDVSICFQRU-UMCKCUICSA-N |
| XLogP | 3.62 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|