C10H9N4O6- — CID 57371508
2-[2-[(2,4-dinitrophenyl)methylidene]hydrazinyl]propanoate (PubChem CID 57371508) has the molecular formula C10H9N4O6- and a molecular weight of 281.20 g/mol. Its IUPAC name is 2-[2-[(2,4-dinitrophenyl)methylidene]hydrazinyl]propanoate.
| Compound Name | 2-[2-[(2,4-dinitrophenyl)methylidene]hydrazinyl]propanoate |
|---|---|
| PubChem CID | 57371508 |
| Molecular Formula | C10H9N4O6- |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[2-[(2,4-dinitrophenyl)methylidene]hydrazinyl]propanoate |
| SMILES | CC(NN=Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H10N4O6/c1-6(10(15)16)12-11-5-7-2-3-8(13(17)18)4-9(7)14(19)20/h2-6,12H,1H3,(H,15,16)/p-1 |
| InChIKey | DQONLLXVLLAKOB-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|