C18H14ClN3O4 — CID 54221493
6-chloro-4-[(2,4-dinitrophenyl)methylidene]-1-ethylquinoline (PubChem CID 54221493) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is 6-chloro-4-[(2,4-dinitrophenyl)methylidene]-1-ethylquinoline.
| Compound Name | 6-chloro-4-[(2,4-dinitrophenyl)methylidene]-1-ethylquinoline |
|---|---|
| PubChem CID | 54221493 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 6-chloro-4-[(2,4-dinitrophenyl)methylidene]-1-ethylquinoline |
| SMILES | CCN1C=CC(=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H14ClN3O4/c1-2-20-8-7-12(16-10-14(19)4-6-17(16)20)9-13-3-5-15(21(23)24)11-18(13)22(25)26/h3-11H,2H2,1H3 |
| InChIKey | QCWZXHKDYIHFFX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|