C18H15N3O4 — CID 21430950
(4Z)-4-[(2,6-dinitrophenyl)methylidene]-1-ethylquinoline (PubChem CID 21430950) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is (4Z)-4-[(2,6-dinitrophenyl)methylidene]-1-ethylquinoline.
| Compound Name | (4Z)-4-[(2,6-dinitrophenyl)methylidene]-1-ethylquinoline |
|---|---|
| PubChem CID | 21430950 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (4Z)-4-[(2,6-dinitrophenyl)methylidene]-1-ethylquinoline |
| SMILES | CCN1C=C/C(=C/c2c([N+](=O)[O-])cccc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C18H15N3O4/c1-2-19-11-10-13(14-6-3-4-7-16(14)19)12-15-17(20(22)23)8-5-9-18(15)21(24)25/h3-12H,2H2,1H3/b13-12- |
| InChIKey | KTDDELREYLBNFG-SEYXRHQNSA-N |
| XLogP | 4.40 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|