C27H18N2O — CID 15888532
2,7-bis[(E)-2-pyridin-4-ylethenyl]fluoren-9-one (PubChem CID 15888532) has the molecular formula C27H18N2O and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,7-bis[(E)-2-pyridin-4-ylethenyl]fluoren-9-one.
| Compound Name | 2,7-bis[(E)-2-pyridin-4-ylethenyl]fluoren-9-one |
|---|---|
| PubChem CID | 15888532 |
| Molecular Formula | C27H18N2O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2,7-bis[(E)-2-pyridin-4-ylethenyl]fluoren-9-one |
| SMILES | O=C1c2cc(/C=C/c3ccncc3)ccc2-c2ccc(/C=C/c3ccncc3)cc21 |
| InChI | InChI=1S/C27H18N2O/c30-27-25-17-21(3-1-19-9-13-28-14-10-19)5-7-23(25)24-8-6-22(18-26(24)27)4-2-20-11-15-29-16-12-20/h1-18H/b3-1+,4-2+ |
| InChIKey | YAAMXNIZRMZZLC-ZPUQHVIOSA-N |
| XLogP | 6.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |