C56H54OP2+2 — CID 57343191
tris(4-methylphenyl)-[[4-[4-[tris(4-methylphenyl)phosphaniumylmethyl]phenoxy]phenyl]methyl]phosphanium (PubChem CID 57343191) has the molecular formula C56H54OP2+2 and a molecular weight of 804.99 g/mol. Its IUPAC name is tris(4-methylphenyl)-[[4-[4-[tris(4-methylphenyl)phosphaniumylmethyl]phenoxy]phenyl]methyl]phosphanium.
| Compound Name | tris(4-methylphenyl)-[[4-[4-[tris(4-methylphenyl)phosphaniumylmethyl]phenoxy]phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 57343191 |
| Molecular Formula | C56H54OP2+2 |
| Molecular Weight | 804.99 g/mol |
| Exact Mass | 804.36 |
| IUPAC Name | tris(4-methylphenyl)-[[4-[4-[tris(4-methylphenyl)phosphaniumylmethyl]phenoxy]phenyl]methyl]phosphanium |
| SMILES | Cc1ccc([P+](Cc2ccc(Oc3ccc(C[P+](c4ccc(C)cc4)(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C56H54OP2/c1-41-7-27-51(28-8-41)58(52-29-9-42(2)10-30-52,53-31-11-43(3)12-32-53)39-47-19-23-49(24-20-47)57-50-25-21-48(22-26-50)40-59(54-33-13-44(4)14-34-54,55-35-15-45(5)16-36-55)56-37-17-46(6)18-38-56/h7-38H,39-40H2,1-6H3/q+2 |
| InChIKey | ZZLPZVBAFAILAZ-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.99 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|