C13H15F3O3S — CID 19349103
[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl] 4-methylbenzenesulfonate (PubChem CID 19349103) has the molecular formula C13H15F3O3S and a molecular weight of 308.32 g/mol. Its IUPAC name is [(Z)-5,5,5-trifluoro-4-methylpent-3-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-5,5,5-trifluoro-4-methylpent-3-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19349103 |
| Molecular Formula | C13H15F3O3S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [(Z)-5,5,5-trifluoro-4-methylpent-3-enyl] 4-methylbenzenesulfonate |
| SMILES | C/C(=C/CCOS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3S/c1-10-5-7-12(8-6-10)20(17,18)19-9-3-4-11(2)13(14,15)16/h4-8H,3,9H2,1-2H3/b11-4- |
| InChIKey | HCTRNJPYKNWDBS-WCIBSUBMSA-N |
| XLogP | 3.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|