C13H13F6NO2S — CID 152780195
4-methyl-N-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butylidene]benzenesulfonamide (PubChem CID 152780195) has the molecular formula C13H13F6NO2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 4-methyl-N-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 152780195 |
| Molecular Formula | C13H13F6NO2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 4-methyl-N-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=CC(CC(F)(F)F)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F6NO2S/c1-9-2-4-11(5-3-9)23(21,22)20-8-10(6-12(14,15)16)7-13(17,18)19/h2-5,8,10H,6-7H2,1H3 |
| InChIKey | LNEGCUFERWGIAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|