C11H12F3NO5S2 — CID 142271865
[(E)-2,2,2-trifluoroethylideneamino] 2-(4-methylphenyl)sulfonylethanesulfonate (PubChem CID 142271865) has the molecular formula C11H12F3NO5S2 and a molecular weight of 359.35 g/mol. Its IUPAC name is [(E)-2,2,2-trifluoroethylideneamino] 2-(4-methylphenyl)sulfonylethanesulfonate.
| Compound Name | [(E)-2,2,2-trifluoroethylideneamino] 2-(4-methylphenyl)sulfonylethanesulfonate |
|---|---|
| PubChem CID | 142271865 |
| Molecular Formula | C11H12F3NO5S2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | [(E)-2,2,2-trifluoroethylideneamino] 2-(4-methylphenyl)sulfonylethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)CCS(=O)(=O)O/N=C/C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO5S2/c1-9-2-4-10(5-3-9)21(16,17)6-7-22(18,19)20-15-8-11(12,13)14/h2-5,8H,6-7H2,1H3/b15-8+ |
| InChIKey | KRHSLIIENLVNGQ-OVCLIPMQSA-N |
| XLogP | 1.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|