C19H32O3S — CID 51032571
(2R,3S,4S)-3,4-dimethyl-1-[(R)-(4-methylphenyl)sulfinyl]decane-2,3-diol (PubChem CID 51032571) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is (2R,3S,4S)-3,4-dimethyl-1-[(R)-(4-methylphenyl)sulfinyl]decane-2,3-diol.
| Compound Name | (2R,3S,4S)-3,4-dimethyl-1-[(R)-(4-methylphenyl)sulfinyl]decane-2,3-diol |
|---|---|
| PubChem CID | 51032571 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (2R,3S,4S)-3,4-dimethyl-1-[(R)-(4-methylphenyl)sulfinyl]decane-2,3-diol |
| SMILES | CCCCCC[C@H](C)[C@](C)(O)[C@@H](O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H32O3S/c1-5-6-7-8-9-16(3)19(4,21)18(20)14-23(22)17-12-10-15(2)11-13-17/h10-13,16,18,20-21H,5-9,14H2,1-4H3/t16-,18-,19-,23+/m0/s1 |
| InChIKey | GCVXOZYRGPDZEV-YRAONVGVSA-N |
| XLogP | 3.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|