C9H9Cl2FOS — CID 164892667
2,2-dichloro-1-(4-fluoro-3-methylsulfanylphenyl)ethanol (PubChem CID 164892667) has the molecular formula C9H9Cl2FOS and a molecular weight of 255.14 g/mol. Its IUPAC name is 2,2-dichloro-1-(4-fluoro-3-methylsulfanylphenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(4-fluoro-3-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 164892667 |
| Molecular Formula | C9H9Cl2FOS |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 2,2-dichloro-1-(4-fluoro-3-methylsulfanylphenyl)ethanol |
| SMILES | CSc1cc(C(O)C(Cl)Cl)ccc1F |
| InChI | InChI=1S/C9H9Cl2FOS/c1-14-7-4-5(2-3-6(7)12)8(13)9(10)11/h2-4,8-9,13H,1H3 |
| InChIKey | MLURSVNTDLUAIQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|