C12H15Cl2FO2 — CID 164893100
1-(4-butoxy-3-fluorophenyl)-2,2-dichloroethanol (PubChem CID 164893100) has the molecular formula C12H15Cl2FO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 1-(4-butoxy-3-fluorophenyl)-2,2-dichloroethanol.
| Compound Name | 1-(4-butoxy-3-fluorophenyl)-2,2-dichloroethanol |
|---|---|
| PubChem CID | 164893100 |
| Molecular Formula | C12H15Cl2FO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(4-butoxy-3-fluorophenyl)-2,2-dichloroethanol |
| SMILES | CCCCOc1ccc(C(O)C(Cl)Cl)cc1F |
| InChI | InChI=1S/C12H15Cl2FO2/c1-2-3-6-17-10-5-4-8(7-9(10)15)11(16)12(13)14/h4-5,7,11-12,16H,2-3,6H2,1H3 |
| InChIKey | WNXVKMMVUCNULP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|