About CID 70331548
CID 70331548 (PubChem CID 70331548) has the molecular formula C10H13BFO2
and a molecular weight of 195.02 g/mol.
Molecular Properties
| Compound Name | CID 70331548 |
| PubChem CID | 70331548 |
| Molecular Formula | C10H13BFO2 |
| Molecular Weight | 195.02 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | — |
| SMILES | CCCCOc1ccc([B]O)cc1F |
| InChI | InChI=1S/C10H13BFO2/c1-2-3-6-14-10-5-4-8(11-13)7-9(10)12/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | OZIYFPSUDXCVFU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.02 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 70331548 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70331548?
The IUPAC name of CID 70331548 (CID 70331548) is not available.
What is the SMILES notation for CID 70331548?
The canonical SMILES for CID 70331548 is CCCCOc1ccc([B]O)cc1F.
What is the InChIKey of CID 70331548?
The InChIKey is OZIYFPSUDXCVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BFO2/c1-2-3-6-14-10-5-4-8(11-13)7-9(10)12/h4-5,7,13H,2-3,6H2,1H3.
What are the key properties of CID 70331548?
CID 70331548 has a molecular weight of 195.02 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70331548 is sourced from PubChem (CID 70331548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).