C17H27NO5 — CID 118267847
(2S,3R)-2-amino-3-(3,4-dibutoxyphenyl)-3-hydroxypropanoic acid (PubChem CID 118267847) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-(3,4-dibutoxyphenyl)-3-hydroxypropanoic acid.
| Compound Name | (2S,3R)-2-amino-3-(3,4-dibutoxyphenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 118267847 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2S,3R)-2-amino-3-(3,4-dibutoxyphenyl)-3-hydroxypropanoic acid |
| SMILES | CCCCOc1ccc([C@@H](O)[C@H](N)C(=O)O)cc1OCCCC |
| InChI | InChI=1S/C17H27NO5/c1-3-5-9-22-13-8-7-12(16(19)15(18)17(20)21)11-14(13)23-10-6-4-2/h7-8,11,15-16,19H,3-6,9-10,18H2,1-2H3,(H,20,21)/t15-,16+/m0/s1 |
| InChIKey | KRVLHZRMLAXWJV-JKSUJKDBSA-N |
| XLogP | 2.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|