C12H13BrO2S — CID 171892154
1-(1-benzothiophen-6-yl)-4-bromobutane-1,2-diol (PubChem CID 171892154) has the molecular formula C12H13BrO2S and a molecular weight of 301.21 g/mol. Its IUPAC name is 1-(1-benzothiophen-6-yl)-4-bromobutane-1,2-diol.
| Compound Name | 1-(1-benzothiophen-6-yl)-4-bromobutane-1,2-diol |
|---|---|
| PubChem CID | 171892154 |
| Molecular Formula | C12H13BrO2S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 1-(1-benzothiophen-6-yl)-4-bromobutane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1ccc2ccsc2c1 |
| InChI | InChI=1S/C12H13BrO2S/c13-5-3-10(14)12(15)9-2-1-8-4-6-16-11(8)7-9/h1-2,4,6-7,10,12,14-15H,3,5H2 |
| InChIKey | BEHOBIJVZMWGSU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|