C12H17BrO4 — CID 171892306
4-bromo-1-[4-(hydroxymethyl)-3-methoxyphenyl]butane-1,2-diol (PubChem CID 171892306) has the molecular formula C12H17BrO4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 4-bromo-1-[4-(hydroxymethyl)-3-methoxyphenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[4-(hydroxymethyl)-3-methoxyphenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892306 |
| Molecular Formula | C12H17BrO4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-bromo-1-[4-(hydroxymethyl)-3-methoxyphenyl]butane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCBr)ccc1CO |
| InChI | InChI=1S/C12H17BrO4/c1-17-11-6-8(2-3-9(11)7-14)12(16)10(15)4-5-13/h2-3,6,10,12,14-16H,4-5,7H2,1H3 |
| InChIKey | CDULFYZSJUBRSS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|