C15H17BrO3 — CID 171892817
4-bromo-1-(2-methoxynaphthalen-1-yl)butane-1,2-diol (PubChem CID 171892817) has the molecular formula C15H17BrO3 and a molecular weight of 325.20 g/mol. Its IUPAC name is 4-bromo-1-(2-methoxynaphthalen-1-yl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(2-methoxynaphthalen-1-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171892817 |
| Molecular Formula | C15H17BrO3 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-bromo-1-(2-methoxynaphthalen-1-yl)butane-1,2-diol |
| SMILES | COc1ccc2ccccc2c1C(O)C(O)CCBr |
| InChI | InChI=1S/C15H17BrO3/c1-19-13-7-6-10-4-2-3-5-11(10)14(13)15(18)12(17)8-9-16/h2-7,12,15,17-18H,8-9H2,1H3 |
| InChIKey | NNZOOIFIECMSIJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|