C8H12O3S — CID 170817278
1-(2-methylthiophen-3-yl)propane-1,2,3-triol (PubChem CID 170817278) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-(2-methylthiophen-3-yl)propane-1,2,3-triol.
| Compound Name | 1-(2-methylthiophen-3-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817278 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-(2-methylthiophen-3-yl)propane-1,2,3-triol |
| SMILES | Cc1sccc1C(O)C(O)CO |
| InChI | InChI=1S/C8H12O3S/c1-5-6(2-3-12-5)8(11)7(10)4-9/h2-3,7-11H,4H2,1H3 |
| InChIKey | UTYQLOSAZCWXJI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |