C13H13F3O6 — CID 171896532
methyl 4-[3-formyl-5-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate (PubChem CID 171896532) has the molecular formula C13H13F3O6 and a molecular weight of 322.24 g/mol. Its IUPAC name is methyl 4-[3-formyl-5-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-[3-formyl-5-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896532 |
| Molecular Formula | C13H13F3O6 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 4-[3-formyl-5-(trifluoromethoxy)phenyl]-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc(C=O)cc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O6/c1-21-11(19)5-10(18)12(20)8-2-7(6-17)3-9(4-8)22-13(14,15)16/h2-4,6,10,12,18,20H,5H2,1H3 |
| InChIKey | IUBSGKCOGVHIGE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|