C11H7BrCl2OS — CID 61082620
(3-bromophenyl)-(2,5-dichlorothiophen-3-yl)methanol (PubChem CID 61082620) has the molecular formula C11H7BrCl2OS and a molecular weight of 338.05 g/mol. Its IUPAC name is (3-bromophenyl)-(2,5-dichlorothiophen-3-yl)methanol.
| Compound Name | (3-bromophenyl)-(2,5-dichlorothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 61082620 |
| Molecular Formula | C11H7BrCl2OS |
| Molecular Weight | 338.05 g/mol |
| Exact Mass | 335.88 |
| IUPAC Name | (3-bromophenyl)-(2,5-dichlorothiophen-3-yl)methanol |
| SMILES | OC(c1cccc(Br)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H7BrCl2OS/c12-7-3-1-2-6(4-7)10(15)8-5-9(13)16-11(8)14/h1-5,10,15H |
| InChIKey | BMCXDXWVFYVQIN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.05 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |