C12H8Br2Cl2S — CID 55199742
3-[1-bromo-2-(3-bromophenyl)ethyl]-2,5-dichlorothiophene (PubChem CID 55199742) has the molecular formula C12H8Br2Cl2S and a molecular weight of 414.98 g/mol. Its IUPAC name is 3-[1-bromo-2-(3-bromophenyl)ethyl]-2,5-dichlorothiophene.
| Compound Name | 3-[1-bromo-2-(3-bromophenyl)ethyl]-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 55199742 |
| Molecular Formula | C12H8Br2Cl2S |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 411.81 |
| IUPAC Name | 3-[1-bromo-2-(3-bromophenyl)ethyl]-2,5-dichlorothiophene |
| SMILES | Clc1cc(C(Br)Cc2cccc(Br)c2)c(Cl)s1 |
| InChI | InChI=1S/C12H8Br2Cl2S/c13-8-3-1-2-7(4-8)5-10(14)9-6-11(15)17-12(9)16/h1-4,6,10H,5H2 |
| InChIKey | FEYYXAUBJNCPIU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|