C13H7Br2ClF3NO — CID 106972099
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dibromophenyl)methanol (PubChem CID 106972099) has the molecular formula C13H7Br2ClF3NO and a molecular weight of 445.46 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dibromophenyl)methanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 106972099 |
| Molecular Formula | C13H7Br2ClF3NO |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 442.85 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-(2,5-dibromophenyl)methanol |
| SMILES | OC(c1cc(Br)ccc1Br)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C13H7Br2ClF3NO/c14-6-1-3-9(15)8(5-6)11(21)7-2-4-10(13(17,18)19)20-12(7)16/h1-5,11,21H |
| InChIKey | YERGDYNJNZFGEM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|