C13H15ClF3NO — CID 106971520
[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-cyclohexylmethanol (PubChem CID 106971520) has the molecular formula C13H15ClF3NO and a molecular weight of 293.72 g/mol. Its IUPAC name is [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-cyclohexylmethanol.
| Compound Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-cyclohexylmethanol |
|---|---|
| PubChem CID | 106971520 |
| Molecular Formula | C13H15ClF3NO |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | [2-chloro-6-(trifluoromethyl)-3-pyridinyl]-cyclohexylmethanol |
| SMILES | OC(c1ccc(C(F)(F)F)nc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C13H15ClF3NO/c14-12-9(6-7-10(18-12)13(15,16)17)11(19)8-4-2-1-3-5-8/h6-8,11,19H,1-5H2 |
| InChIKey | XLEHTMTUCFXXRG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|