C13H12BrClOS — CID 61088539
(4-bromo-2-chlorophenyl)-(2,5-dimethylthiophen-3-yl)methanol (PubChem CID 61088539) has the molecular formula C13H12BrClOS and a molecular weight of 331.66 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl)-(2,5-dimethylthiophen-3-yl)methanol.
| Compound Name | (4-bromo-2-chlorophenyl)-(2,5-dimethylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 61088539 |
| Molecular Formula | C13H12BrClOS |
| Molecular Weight | 331.66 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | (4-bromo-2-chlorophenyl)-(2,5-dimethylthiophen-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2ccc(Br)cc2Cl)c(C)s1 |
| InChI | InChI=1S/C13H12BrClOS/c1-7-5-11(8(2)17-7)13(16)10-4-3-9(14)6-12(10)15/h3-6,13,16H,1-2H3 |
| InChIKey | NDOGQOUCVKAYPU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |