C17H10Br2F2 — CID 79590922
1-bromo-4-[bromo-(2,4-difluorophenyl)methyl]naphthalene (PubChem CID 79590922) has the molecular formula C17H10Br2F2 and a molecular weight of 412.07 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(2,4-difluorophenyl)methyl]naphthalene.
| Compound Name | 1-bromo-4-[bromo-(2,4-difluorophenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 79590922 |
| Molecular Formula | C17H10Br2F2 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 1-bromo-4-[bromo-(2,4-difluorophenyl)methyl]naphthalene |
| SMILES | Fc1ccc(C(Br)c2ccc(Br)c3ccccc23)c(F)c1 |
| InChI | InChI=1S/C17H10Br2F2/c18-15-8-7-13(11-3-1-2-4-12(11)15)17(19)14-6-5-10(20)9-16(14)21/h1-9,17H |
| InChIKey | BMDHSKRQIVVCSC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|