C6H2BrCl2F3S — CID 61097775
3-(1-bromo-2,2,2-trifluoroethyl)-2,5-dichlorothiophene (PubChem CID 61097775) has the molecular formula C6H2BrCl2F3S and a molecular weight of 313.95 g/mol. Its IUPAC name is 3-(1-bromo-2,2,2-trifluoroethyl)-2,5-dichlorothiophene.
| Compound Name | 3-(1-bromo-2,2,2-trifluoroethyl)-2,5-dichlorothiophene |
|---|---|
| PubChem CID | 61097775 |
| Molecular Formula | C6H2BrCl2F3S |
| Molecular Weight | 313.95 g/mol |
| Exact Mass | 311.84 |
| IUPAC Name | 3-(1-bromo-2,2,2-trifluoroethyl)-2,5-dichlorothiophene |
| SMILES | FC(F)(F)C(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C6H2BrCl2F3S/c7-4(6(10,11)12)2-1-3(8)13-5(2)9/h1,4H |
| InChIKey | LMGGYWQUIWQCEM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|