C14H10Br2F2S — CID 79206926
1-bromo-4-[bromo-(2-methylsulfanylphenyl)methyl]-2,5-difluorobenzene (PubChem CID 79206926) has the molecular formula C14H10Br2F2S and a molecular weight of 408.11 g/mol. Its IUPAC name is 1-bromo-4-[bromo-(2-methylsulfanylphenyl)methyl]-2,5-difluorobenzene.
| Compound Name | 1-bromo-4-[bromo-(2-methylsulfanylphenyl)methyl]-2,5-difluorobenzene |
|---|---|
| PubChem CID | 79206926 |
| Molecular Formula | C14H10Br2F2S |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 1-bromo-4-[bromo-(2-methylsulfanylphenyl)methyl]-2,5-difluorobenzene |
| SMILES | CSc1ccccc1C(Br)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C14H10Br2F2S/c1-19-13-5-3-2-4-8(13)14(16)9-6-12(18)10(15)7-11(9)17/h2-7,14H,1H3 |
| InChIKey | VQEDSDKAUJAJDN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|