C17H15Cl3 — CID 63430631
6-[chloro-(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63430631) has the molecular formula C17H15Cl3 and a molecular weight of 325.67 g/mol. Its IUPAC name is 6-[chloro-(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[chloro-(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63430631 |
| Molecular Formula | C17H15Cl3 |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 6-[chloro-(3,4-dichlorophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Clc1ccc(C(Cl)c2ccc3c(c2)CCCC3)cc1Cl |
| InChI | InChI=1S/C17H15Cl3/c18-15-8-7-14(10-16(15)19)17(20)13-6-5-11-3-1-2-4-12(11)9-13/h5-10,17H,1-4H2 |
| InChIKey | XSLWSCMZJVJRHT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|