C17H15Cl2I — CID 103210512
6-[chloro-(3-chloro-4-iodophenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 103210512) has the molecular formula C17H15Cl2I and a molecular weight of 417.12 g/mol. Its IUPAC name is 6-[chloro-(3-chloro-4-iodophenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[chloro-(3-chloro-4-iodophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 103210512 |
| Molecular Formula | C17H15Cl2I |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 6-[chloro-(3-chloro-4-iodophenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Clc1cc(C(Cl)c2ccc3c(c2)CCCC3)ccc1I |
| InChI | InChI=1S/C17H15Cl2I/c18-15-10-14(7-8-16(15)20)17(19)13-6-5-11-3-1-2-4-12(11)9-13/h5-10,17H,1-4H2 |
| InChIKey | IAUKKYVBJMFMQO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|