C15H14BrClS — CID 114021592
2-bromo-4-[chloro(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]thiophene (PubChem CID 114021592) has the molecular formula C15H14BrClS and a molecular weight of 341.70 g/mol. Its IUPAC name is 2-bromo-4-[chloro(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]thiophene.
| Compound Name | 2-bromo-4-[chloro(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]thiophene |
|---|---|
| PubChem CID | 114021592 |
| Molecular Formula | C15H14BrClS |
| Molecular Weight | 341.70 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-bromo-4-[chloro(5,6,7,8-tetrahydronaphthalen-2-yl)methyl]thiophene |
| SMILES | ClC(c1csc(Br)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H14BrClS/c16-14-8-13(9-18-14)15(17)12-6-5-10-3-1-2-4-11(10)7-12/h5-9,15H,1-4H2 |
| InChIKey | PBADKMNYVBNGNA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|