C13H8BrClN2O2S — CID 107964474
6-[(5-bromothiophen-3-yl)-chloromethyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 107964474) has the molecular formula C13H8BrClN2O2S and a molecular weight of 371.64 g/mol. Its IUPAC name is 6-[(5-bromothiophen-3-yl)-chloromethyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(5-bromothiophen-3-yl)-chloromethyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 107964474 |
| Molecular Formula | C13H8BrClN2O2S |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 6-[(5-bromothiophen-3-yl)-chloromethyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(C(Cl)c3csc(Br)c3)cc2[nH]c1=O |
| InChI | InChI=1S/C13H8BrClN2O2S/c14-10-4-7(5-20-10)11(15)6-1-2-8-9(3-6)17-13(19)12(18)16-8/h1-5,11H,(H,16,18)(H,17,19) |
| InChIKey | SLOWKFPHPDBFCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|