C12H8BrClN2O2 — CID 61085785
5-[(5-bromofuran-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 61085785) has the molecular formula C12H8BrClN2O2 and a molecular weight of 327.57 g/mol. Its IUPAC name is 5-[(5-bromofuran-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(5-bromofuran-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 61085785 |
| Molecular Formula | C12H8BrClN2O2 |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 5-[(5-bromofuran-2-yl)-chloromethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)c3ccc(Br)o3)cc2[nH]1 |
| InChI | InChI=1S/C12H8BrClN2O2/c13-10-4-3-9(18-10)11(14)6-1-2-7-8(5-6)16-12(17)15-7/h1-5,11H,(H2,15,16,17) |
| InChIKey | GXWOTSDHOQRWHP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|