C14H9Br2ClN2O — CID 107980822
5-[chloro-(3,5-dibromophenyl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 107980822) has the molecular formula C14H9Br2ClN2O and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-[chloro-(3,5-dibromophenyl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[chloro-(3,5-dibromophenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 107980822 |
| Molecular Formula | C14H9Br2ClN2O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | 5-[chloro-(3,5-dibromophenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)c3cc(Br)cc(Br)c3)cc2[nH]1 |
| InChI | InChI=1S/C14H9Br2ClN2O/c15-9-3-8(4-10(16)6-9)13(17)7-1-2-11-12(5-7)19-14(20)18-11/h1-6,13H,(H2,18,19,20) |
| InChIKey | XTGUUPOPKIJEIH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|