C13H11ClN2O2 — CID 61085783
5-[chloro-(2-methylfuran-3-yl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 61085783) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 5-[chloro-(2-methylfuran-3-yl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[chloro-(2-methylfuran-3-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 61085783 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 5-[chloro-(2-methylfuran-3-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1occc1C(Cl)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H11ClN2O2/c1-7-9(4-5-18-7)12(14)8-2-3-10-11(6-8)16-13(17)15-10/h2-6,12H,1H3,(H2,15,16,17) |
| InChIKey | ITZUBZOZTKMQTJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|